CAS 2349402-75-9 appears in our catalog under these names: (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-fluoro-4-methylpentanoic acid, 95%, 95%, Fmoc-L-Leu(4-F)-OH, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluoro-4-methylpentanoic acid (CAS 2349402-75-9) is a chemical compound with the molecular formula C21H22FNO4 and a molecular weight of 371.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluoro-4-methylpentanoic acid. InChIKey: ADWVMTICITYHRE-SFHVURJKSA-N.
| Molecular formula | C21H22FNO4 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluoro-4-methylpentanoic acid |
| InChIKey | ADWVMTICITYHRE-SFHVURJKSA-N |
| SMILES | CC(C)(C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)F |
Computed by PubChem (NCBI)