CAS 2118954-10-0 is the registry number for exo-3-Amino-9-methyl-9-azabicyclo[3.3.1]nonane Dihydrochloride, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine;dihydrochloride (CAS 2118954-10-0) is a chemical compound with the molecular formula C9H20Cl2N2 and a molecular weight of 227.17 g/mol. IUPAC name: (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine;dihydrochloride. InChIKey: ZYQLBGNYBPWAFH-XFRIOYGNSA-N.
| Molecular formula | C9H20Cl2N2 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine;dihydrochloride |
| InChIKey | ZYQLBGNYBPWAFH-XFRIOYGNSA-N |
| SMILES | CN1[C@@H]2CCC[C@H]1CC(C2)N.Cl.Cl |
Computed by PubChem (NCBI)