CAS 21203-68-9 appears in our catalog under these names: 2–Methyl–5–nitropyridine, 2-Methyl-5-nitropyridine, 95% , 2-Methyl-5-nitropyridine, 2-Methyl-5-nitropyridine, >96.0%(GC)(T), 2-Methyl-5-nitropyridine 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 50g, 1g, 250g, 10g, 500g.
2-methyl-5-nitropyridine (CAS 21203-68-9) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 2-methyl-5-nitropyridine. InChIKey: USZINSZJSVMICC-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | 2-methyl-5-nitropyridine |
| InChIKey | USZINSZJSVMICC-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)