CAS 21210-90-2 appears in our catalog under these names: 2,5–Di(2–thienyl)thieno(3,2–b)thiophene, 2,5-Di(2-thienyl)thieno[3,2-b]thiophene, >94.0%(GC), 2,5-Di(thiophen-2-yl)thieno[3,2-b]thiophene 98%, 2,5-Di(thiophen-2-yl)thieno[3,2-b]thiophene, 98%, 98%, 2,5-Di(thiophen-2-yl)thieno[3,2-b]thiophene, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 5g, 100mg, 250mg.
2,5-dithiophen-2-ylthieno[3,2-b]thiophene (CAS 21210-90-2) is a chemical compound with the molecular formula C14H8S4 and a molecular weight of 304.5 g/mol. IUPAC name: 2,5-dithiophen-2-ylthieno[3,2-b]thiophene. InChIKey: FDQXVHKNZBLBFY-UHFFFAOYSA-N.
| Molecular formula | C14H8S4 |
|---|---|
| Molecular weight | 304.5 g/mol |
| IUPAC name | 2,5-dithiophen-2-ylthieno[3,2-b]thiophene |
| InChIKey | FDQXVHKNZBLBFY-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC3=C(S2)C=C(S3)C4=CC=CS4 |
Computed by PubChem (NCBI)