CAS 24648-13-3 appears in our catalog under these names: Dibenzotetrathiafulvalene, 97%, Dibenzotetrathiafulvalene. Offered by: Combi-blocks, Biosynth, Sigma-Aldrich. Available pack sizes: 500mg, 250mg, 100mg, 1000mg.
2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole (CAS 24648-13-3) is a chemical compound with the molecular formula C14H8S4 and a molecular weight of 304.5 g/mol. IUPAC name: 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole. InChIKey: OVIRUXIWCFZJQC-UHFFFAOYSA-N.
| Molecular formula | C14H8S4 |
|---|---|
| Molecular weight | 304.5 g/mol |
| IUPAC name | 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole |
| InChIKey | OVIRUXIWCFZJQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)SC(=C3SC4=CC=CC=C4S3)S2 |
Computed by PubChem (NCBI)