CAS 212139-17-8 appears in our catalog under these names: Cyclopropyl(2,4-dichlorophenyl)methanone 95%, Cyclopropyl 2,4-dichlorophenyl ketone, 95%, 95%, Cyclopropyl 2,4-dichlorophenyl ketone, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Cyclopropyl-(2,4-dichlorophenyl)methanone (CAS 212139-17-8) is a chemical compound with the molecular formula C10H8Cl2O and a molecular weight of 215.07 g/mol. IUPAC name: cyclopropyl-(2,4-dichlorophenyl)methanone. InChIKey: FKVIAPZURIOARE-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O |
|---|---|
| Molecular weight | 215.07 g/mol |
| IUPAC name | cyclopropyl-(2,4-dichlorophenyl)methanone |
| InChIKey | FKVIAPZURIOARE-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)