Products 2121511-52-0

CAS 2121511-52-0 is the registry number for 5-Bromo-2-isopropoxypyridine-3-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(5-bromo-2-propan-2-yloxy-3-pyridinyl)boronic acid (CAS 2121511-52-0) is a chemical compound with the molecular formula C8H11BBrNO3 and a molecular weight of 259.90 g/mol. IUPAC name: (5-bromo-2-propan-2-yloxy-3-pyridinyl)boronic acid. InChIKey: JPTYGTGGOGLVSF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11BBrNO3
Molecular weight259.90 g/mol
IUPAC name(5-bromo-2-propan-2-yloxy-3-pyridinyl)boronic acid
InChIKeyJPTYGTGGOGLVSF-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1OC(C)C)Br)(O)O

Computed by PubChem (NCBI)