CAS 2641451-77-4 appears in our catalog under these names: (S)-(5-Bromo-6-(1-methoxyethyl)pyridin-3-yl)boronic acid, 95%, 95%, (S)-(5-Bromo-6-(1-methoxyethyl)pyridin-3-yl)boronic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
[5-bromo-6-[(1S)-1-methoxyethyl]-3-pyridinyl]boronic acid (CAS 2641451-77-4) is a chemical compound with the molecular formula C8H11BBrNO3 and a molecular weight of 259.90 g/mol. IUPAC name: [5-bromo-6-[(1S)-1-methoxyethyl]-3-pyridinyl]boronic acid. InChIKey: JEPYQUKNZZPUMH-YFKPBYRVSA-N.
| Molecular formula | C8H11BBrNO3 |
|---|---|
| Molecular weight | 259.90 g/mol |
| IUPAC name | [5-bromo-6-[(1S)-1-methoxyethyl]-3-pyridinyl]boronic acid |
| InChIKey | JEPYQUKNZZPUMH-YFKPBYRVSA-N |
| SMILES | B(C1=CC(=C(N=C1)[C@H](C)OC)Br)(O)O |
Computed by PubChem (NCBI)