CAS 2121512-02-3 is the registry number for 2,4-Dibromo-5-fluorophenylboronic acid pincol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(2,4-dibromo-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-02-3) is a chemical compound with the molecular formula C12H14BBr2FO2 and a molecular weight of 379.86 g/mol. IUPAC name: 2-(2,4-dibromo-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RCBWOFXGVZQBON-UHFFFAOYSA-N.
| Molecular formula | C12H14BBr2FO2 |
|---|---|
| Molecular weight | 379.86 g/mol |
| IUPAC name | 2-(2,4-dibromo-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RCBWOFXGVZQBON-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2Br)Br)F |
Computed by PubChem (NCBI)