CAS 2121512-09-0 appears in our catalog under these names: 2,4-Dibromo-6-fluorophenylboronic acid pinacol ester, 97%, 2-(2,4-Dibromo-6-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 2,4-Dibromo-6-fluorophenylboronic acid pinacol ester, 98%, 98%, 2,4-Dibromo-6-fluorophenylboronic acid pinacol ester. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 10g, 5g, 1g.
2-(2,4-dibromo-6-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-09-0) is a chemical compound with the molecular formula C12H14BBr2FO2 and a molecular weight of 379.86 g/mol. IUPAC name: 2-(2,4-dibromo-6-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UBSYNNGKKUAXKI-UHFFFAOYSA-N.
| Molecular formula | C12H14BBr2FO2 |
|---|---|
| Molecular weight | 379.86 g/mol |
| IUPAC name | 2-(2,4-dibromo-6-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UBSYNNGKKUAXKI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2Br)Br)F |
Computed by PubChem (NCBI)