CAS 2121512-39-6 appears in our catalog under these names: 2,4-Dichloro-5-methylphenylboronic acid pinacol ester, 95%, 2-(2,4-Dichloro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 2,4-Dichloro-5-methylphenylboronic acid pinacol ester. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg.
2-(2,4-dichloro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-39-6) is a chemical compound with the molecular formula C13H17BCl2O2 and a molecular weight of 287.0 g/mol. IUPAC name: 2-(2,4-dichloro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UQXGXRURODWRIA-UHFFFAOYSA-N.
| Molecular formula | C13H17BCl2O2 |
|---|---|
| Molecular weight | 287.0 g/mol |
| IUPAC name | 2-(2,4-dichloro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UQXGXRURODWRIA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2Cl)Cl)C |
Computed by PubChem (NCBI)