Products 942069-73-0
CAS 942069-73-0 is the registry number for 2-(3,5-Dichloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 250mg, 100mg, 25g, 10g.
2-(3,5-dichloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 942069-73-0) is a chemical compound with the molecular formula C13H17BCl2O2 and a molecular weight of 287.0 g/mol. IUPAC name: 2-(3,5-dichloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SZTBWTOKHBQRKC-UHFFFAOYSA-N.
| Molecular formula | C13H17BCl2O2 |
|---|---|
| Molecular weight | 287.0 g/mol |
| IUPAC name | 2-(3,5-dichloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SZTBWTOKHBQRKC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)Cl)C)Cl |
Computed by PubChem (NCBI)