Products 2170373-07-4
CAS 2170373-07-4 is the registry number for 1-(3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol (CAS 2170373-07-4) is a chemical compound with the molecular formula C14H20BFO3 and a molecular weight of 266.12 g/mol. IUPAC name: 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol. InChIKey: SCKMVDOWLDDXJJ-UHFFFAOYSA-N.
| Molecular formula | C14H20BFO3 |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol |
| InChIKey | SCKMVDOWLDDXJJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(C)O)F |
Computed by PubChem (NCBI)