CAS 2121513-09-3 is the registry number for 4-Chloro-2,3-difluoro-5-methoxyphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(4-chloro-2,3-difluoro-5-methoxyphenyl)boronic acid (CAS 2121513-09-3) is a chemical compound with the molecular formula C7H6BClF2O3 and a molecular weight of 222.38 g/mol. IUPAC name: (4-chloro-2,3-difluoro-5-methoxyphenyl)boronic acid. InChIKey: YDAUCOBRCLRBTC-UHFFFAOYSA-N.
| Molecular formula | C7H6BClF2O3 |
|---|---|
| Molecular weight | 222.38 g/mol |
| IUPAC name | (4-chloro-2,3-difluoro-5-methoxyphenyl)boronic acid |
| InChIKey | YDAUCOBRCLRBTC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)F)Cl)OC)(O)O |
Computed by PubChem (NCBI)