Products 2121513-09-3

CAS 2121513-09-3 is the registry number for 4-Chloro-2,3-difluoro-5-methoxyphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(4-chloro-2,3-difluoro-5-methoxyphenyl)boronic acid (CAS 2121513-09-3) is a chemical compound with the molecular formula C7H6BClF2O3 and a molecular weight of 222.38 g/mol. IUPAC name: (4-chloro-2,3-difluoro-5-methoxyphenyl)boronic acid. InChIKey: YDAUCOBRCLRBTC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BClF2O3
Molecular weight222.38 g/mol
IUPAC name(4-chloro-2,3-difluoro-5-methoxyphenyl)boronic acid
InChIKeyYDAUCOBRCLRBTC-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1F)F)Cl)OC)(O)O

Computed by PubChem (NCBI)