CAS 313545-33-4 appears in our catalog under these names: (2–Chloro–4–(difluoromethoxy)phenyl)boronic acid, (2-Chloro-4-(difluoromethoxy)phenyl)boronic acid, 95%, (2-Chloro-4-(difluoromethoxy)phenyl)boronic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
[2-chloro-4-(difluoromethoxy)phenyl]boronic acid (CAS 313545-33-4) is a chemical compound with the molecular formula C7H6BClF2O3 and a molecular weight of 222.38 g/mol. IUPAC name: [2-chloro-4-(difluoromethoxy)phenyl]boronic acid. InChIKey: VGTCSOILLLIGBD-UHFFFAOYSA-N.
| Molecular formula | C7H6BClF2O3 |
|---|---|
| Molecular weight | 222.38 g/mol |
| IUPAC name | [2-chloro-4-(difluoromethoxy)phenyl]boronic acid |
| InChIKey | VGTCSOILLLIGBD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC(F)F)Cl)(O)O |
Computed by PubChem (NCBI)