Products 2121513-10-6

CAS 2121513-10-6 is the registry number for 3,4-Dibromothiophene-2-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(3,4-dibromothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121513-10-6) is a chemical compound with the molecular formula C10H13BBr2O2S and a molecular weight of 367.90 g/mol. IUPAC name: 2-(3,4-dibromothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RUWLVVJDJCPLAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13BBr2O2S
Molecular weight367.90 g/mol
IUPAC name2-(3,4-dibromothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
InChIKeyRUWLVVJDJCPLAQ-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=C(C(=CS2)Br)Br

Computed by PubChem (NCBI)