CAS 942070-22-6 appears in our catalog under these names: 2-(2,5-Dibromothiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 2-(2,5-Dibromothiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g.
2-(2,5-dibromothiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 942070-22-6) is a chemical compound with the molecular formula C10H13BBr2O2S and a molecular weight of 367.90 g/mol. IUPAC name: 2-(2,5-dibromothiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FBVYFWMGZNOTBO-UHFFFAOYSA-N.
| Molecular formula | C10H13BBr2O2S |
|---|---|
| Molecular weight | 367.90 g/mol |
| IUPAC name | 2-(2,5-dibromothiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FBVYFWMGZNOTBO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC(=C2)Br)Br |
Computed by PubChem (NCBI)