CAS 2121513-30-0 appears in our catalog under these names: 4-Chloro-1h-indazol-7-ylboronic acid, 95%, (4-chloro-2H-indazol-7-yl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
(4-chloro-1H-indazol-7-yl)boronic acid (CAS 2121513-30-0) is a chemical compound with the molecular formula C7H6BClN2O2 and a molecular weight of 196.40 g/mol. IUPAC name: (4-chloro-1H-indazol-7-yl)boronic acid. InChIKey: JKWKQHLAXCIJRX-UHFFFAOYSA-N.
| Molecular formula | C7H6BClN2O2 |
|---|---|
| Molecular weight | 196.40 g/mol |
| IUPAC name | (4-chloro-1H-indazol-7-yl)boronic acid |
| InChIKey | JKWKQHLAXCIJRX-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=C(C=C1)Cl)C=NN2)(O)O |
Computed by PubChem (NCBI)