CAS 2916377-29-0 is the registry number for (4-Chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)boronic acid (CAS 2916377-29-0) is a chemical compound with the molecular formula C7H6BClN2O2 and a molecular weight of 196.40 g/mol. IUPAC name: (4-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)boronic acid. InChIKey: AXBILWUJPIJJQS-UHFFFAOYSA-N.
| Molecular formula | C7H6BClN2O2 |
|---|---|
| Molecular weight | 196.40 g/mol |
| IUPAC name | (4-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)boronic acid |
| InChIKey | AXBILWUJPIJJQS-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C2C(=C1Cl)C=CN2)(O)O |
Computed by PubChem (NCBI)