CAS 2121513-95-7 is the registry number for 3-Chloro2-ethoxypyridine-4-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
3-chloro-2-ethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2121513-95-7) is a chemical compound with the molecular formula C13H19BClNO3 and a molecular weight of 283.56 g/mol. IUPAC name: 3-chloro-2-ethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: DDPDNUWYJSEOCY-UHFFFAOYSA-N.
| Molecular formula | C13H19BClNO3 |
|---|---|
| Molecular weight | 283.56 g/mol |
| IUPAC name | 3-chloro-2-ethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | DDPDNUWYJSEOCY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)OCC)Cl |
Computed by PubChem (NCBI)