CAS 2223029-21-6 is the registry number for 2-Chloro-3-ethoxy-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-3-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2223029-21-6) is a chemical compound with the molecular formula C13H19BClNO3 and a molecular weight of 283.56 g/mol. IUPAC name: 2-chloro-3-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: UNMUOFGKZJZHPL-UHFFFAOYSA-N.
| Molecular formula | C13H19BClNO3 |
|---|---|
| Molecular weight | 283.56 g/mol |
| IUPAC name | 2-chloro-3-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | UNMUOFGKZJZHPL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)Cl)OCC |
Computed by PubChem (NCBI)