Products 2121894-58-2
CAS 2121894-58-2 is the registry number for tert-Butyl 5-cyano-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 5-cyano-2,3-dihydropyrrolo[3,2-b]pyridine-1-carboxylate (CAS 2121894-58-2) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: tert-butyl 5-cyano-2,3-dihydropyrrolo[3,2-b]pyridine-1-carboxylate. InChIKey: JTUIWBFGTAFNSZ-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | tert-butyl 5-cyano-2,3-dihydropyrrolo[3,2-b]pyridine-1-carboxylate |
| InChIKey | JTUIWBFGTAFNSZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C=CC(=N2)C#N |
Computed by PubChem (NCBI)