Products 2122184-62-5

CAS 2122184-62-5 is the registry number for 2-Hydroxy-bexarotene, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.

Structural formula: {0} (CAS {1})

4-[2-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]benzoic acid (CAS 2122184-62-5) is a chemical compound with the molecular formula C24H30O3 and a molecular weight of 366.5 g/mol. IUPAC name: 4-[2-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]benzoic acid. InChIKey: DYDLNAHYXNCVDM-UHFFFAOYSA-N.

Identity
Molecular formulaC24H30O3
Molecular weight366.5 g/mol
IUPAC name4-[2-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]benzoic acid
InChIKeyDYDLNAHYXNCVDM-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1C(CO)C3=CC=C(C=C3)C(=O)O)C(CCC2(C)C)(C)C

Computed by PubChem (NCBI)