CAS 2122184-62-5 is the registry number for 2-Hydroxy-bexarotene, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
4-[2-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]benzoic acid (CAS 2122184-62-5) is a chemical compound with the molecular formula C24H30O3 and a molecular weight of 366.5 g/mol. IUPAC name: 4-[2-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]benzoic acid. InChIKey: DYDLNAHYXNCVDM-UHFFFAOYSA-N.
| Molecular formula | C24H30O3 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | 4-[2-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]benzoic acid |
| InChIKey | DYDLNAHYXNCVDM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(CO)C3=CC=C(C=C3)C(=O)O)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)