CAS 6805-34-1 appears in our catalog under these names: Ferulenol, Ferulenol, 99.0%, 99.0%, Ferulenol, 99.0%. Offered by: GLPBio, TRC, Chemat, MedChemExpress. Available pack sizes: 1mg, 50mg, 10mg, 5mg, 5 mg.
4-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one (CAS 6805-34-1) is a chemical compound with the molecular formula C24H30O3 and a molecular weight of 366.5 g/mol. IUPAC name: 4-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one. InChIKey: NJJDBBUWWOAOLD-CFBAGHHKSA-N.
| Molecular formula | C24H30O3 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | 4-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]chromen-2-one |
| InChIKey | NJJDBBUWWOAOLD-CFBAGHHKSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C/CC1=C(C2=CC=CC=C2OC1=O)O)/C)/C)C |
Computed by PubChem (NCBI)