CAS 212264-29-4 is the registry number for 4-(Benzylthio)-1,3,5-triazin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
4-benzylsulfanyl-1,3,5-triazin-2-amine (CAS 212264-29-4) is a chemical compound with the molecular formula C10H10N4S and a molecular weight of 218.28 g/mol. IUPAC name: 4-benzylsulfanyl-1,3,5-triazin-2-amine. InChIKey: ZBUGQVVHNVVMIS-UHFFFAOYSA-N.
| Molecular formula | C10H10N4S |
|---|---|
| Molecular weight | 218.28 g/mol |
| IUPAC name | 4-benzylsulfanyl-1,3,5-triazin-2-amine |
| InChIKey | ZBUGQVVHNVVMIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NC=NC(=N2)N |
Computed by PubChem (NCBI)