CAS 2507-81-5 appears in our catalog under these names: N-(4-Phenyl-1,3-thiazol-2-yl)guanidine, 95%, 1-(4-Phenylthiazol-2-yl)guanidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(4-phenyl-1,3-thiazol-2-yl)guanidine (CAS 2507-81-5) is a chemical compound with the molecular formula C10H10N4S and a molecular weight of 218.28 g/mol. IUPAC name: 2-(4-phenyl-1,3-thiazol-2-yl)guanidine. InChIKey: GENKQMMVXFFZPC-UHFFFAOYSA-N.
| Molecular formula | C10H10N4S |
|---|---|
| Molecular weight | 218.28 g/mol |
| IUPAC name | 2-(4-phenyl-1,3-thiazol-2-yl)guanidine |
| InChIKey | GENKQMMVXFFZPC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)N=C(N)N |
Computed by PubChem (NCBI)