CAS 212328-84-2 is the registry number for Arginine-1-13C dihydrochloride. Offered by: TRC. Available pack sizes: 25mg.
2-amino-5-(diaminomethylideneamino)(113C)pentanoic acid;dihydrochloride (CAS 212328-84-2) is a chemical compound with the molecular formula C6H16Cl2N4O2 and a molecular weight of 248.11 g/mol. IUPAC name: 2-amino-5-(diaminomethylideneamino)(113C)pentanoic acid;dihydrochloride. InChIKey: CIFDKEOHAJGWGZ-XLCWSWKCSA-N.
| Molecular formula | C6H16Cl2N4O2 |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | 2-amino-5-(diaminomethylideneamino)(113C)pentanoic acid;dihydrochloride |
| InChIKey | CIFDKEOHAJGWGZ-XLCWSWKCSA-N |
| SMILES | C(CC([13C](=O)O)N)CN=C(N)N.Cl.Cl |
Computed by PubChem (NCBI)