CAS 58107-60-1 is the registry number for L-arginine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;dihydrochloride (CAS 58107-60-1) is a chemical compound with the molecular formula C6H16Cl2N4O2 and a molecular weight of 247.12 g/mol. IUPAC name: (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;dihydrochloride. InChIKey: CIFDKEOHAJGWGZ-FHNDMYTFSA-N.
| Molecular formula | C6H16Cl2N4O2 |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;dihydrochloride |
| InChIKey | CIFDKEOHAJGWGZ-FHNDMYTFSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CN=C(N)N.Cl.Cl |
Computed by PubChem (NCBI)