CAS 2124-47-2 appears in our catalog under these names: 2,4–Dimethyl–5–nitroaniline, 2,4-Dimethyl-5-nitroaniline, >98.0%(GC)(T), 2,4-Dimethyl-5-nitroaniline 97%, 2,4-Dimethyl-5-nitroaniline, 97%, 97%, 2,4-Dimethyl-5-nitroaniline, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
2,4-dimethyl-5-nitroaniline (CAS 2124-47-2) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2,4-dimethyl-5-nitroaniline. InChIKey: DUIOVGPUAJSYCD-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2,4-dimethyl-5-nitroaniline |
| InChIKey | DUIOVGPUAJSYCD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N)[N+](=O)[O-])C |
Computed by PubChem (NCBI)