Products 2124-55-2
CAS 2124-55-2 appears in our catalog under these names: Indole–4–carboxylic Acid, Indole-4-carboxylic acid, Indole-4-carboxylic Acid, >98.0%(GC)(T), INDOLE-4-CARBOXYLIC ACID, 99%, Indole-4-carboxylicacid, 98%, 98%. Offered by: GLPBio, Biosynth, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 25g, 5g, 50g, 1g, 500MG, 10g, 15g.
1H-indole-4-carboxylic acid (CAS 2124-55-2) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 1H-indole-4-carboxylic acid. InChIKey: ROGHUJUFCRFUSO-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 1H-indole-4-carboxylic acid |
| InChIKey | ROGHUJUFCRFUSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CNC2=C1)C(=O)O |
Computed by PubChem (NCBI)