CAS 2124296-39-3 is the registry number for 3Alpha-Phenylacetoxy Tropane-d5. Offered by: TRC. Available pack sizes: 100mg, 10mg.
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(2,3,4,5,6-pentadeuteriophenyl)acetate (CAS 2124296-39-3) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 264.37 g/mol. IUPAC name: [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(2,3,4,5,6-pentadeuteriophenyl)acetate. InChIKey: DCINQANYMBYYCH-RYKSEBQISA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 264.37 g/mol |
| IUPAC name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(2,3,4,5,6-pentadeuteriophenyl)acetate |
| InChIKey | DCINQANYMBYYCH-RYKSEBQISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CC(=O)OC2C[C@H]3CC[C@@H](C2)N3C)[2H])[2H] |
Computed by PubChem (NCBI)