CAS 21243-20-9 appears in our catalog under these names: 8-Fluoro-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1,4-trione, 95%, 8-​Fluoro-​2,​3-​dihydro-4H-​1-​benzothiopyran-​4-​one 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
8-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one (CAS 21243-20-9) is a chemical compound with the molecular formula C9H7FO3S and a molecular weight of 214.22 g/mol. IUPAC name: 8-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one. InChIKey: GGROUAVJFZEUQS-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3S |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 8-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one |
| InChIKey | GGROUAVJFZEUQS-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C(C1=O)C=CC=C2F |
Computed by PubChem (NCBI)