Products 2918835-34-2
CAS 2918835-34-2 is the registry number for 2-fluoro-6-formyl-3-(methylthio)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-fluoro-6-formyl-3-methylsulfanylbenzoic acid (CAS 2918835-34-2) is a chemical compound with the molecular formula C9H7FO3S and a molecular weight of 214.22 g/mol. IUPAC name: 2-fluoro-6-formyl-3-methylsulfanylbenzoic acid. InChIKey: AGOSYNJCBZFGEK-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3S |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-fluoro-6-formyl-3-methylsulfanylbenzoic acid |
| InChIKey | AGOSYNJCBZFGEK-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(C=C1)C=O)C(=O)O)F |
Computed by PubChem (NCBI)