Products 212515-76-9
CAS 212515-76-9 appears in our catalog under these names: 4-(3,5-Dimethylisoxazol-4-yl)benzoic acid, 98%, 98%, 4-(3,5-Dimethylisoxazol-4-yl)benzoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid (CAS 212515-76-9) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 4-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid. InChIKey: GDLMOSFOLPYNIR-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 4-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid |
| InChIKey | GDLMOSFOLPYNIR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)