CAS 2125943-82-8 appears in our catalog under these names: trans-2-fluorocyclopentan-1-amine hydrochloride, 97%, trans-2-Fluorocyclopentan-1-amine HCl ee. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 50mg, 0,5g.
Trans-(1R,2R)-2-fluorocyclopentan-1-amine;hydrochloride (CAS 2125943-82-8) is a chemical compound with the molecular formula C5H11ClFN and a molecular weight of 139.60 g/mol. IUPAC name: trans-(1R,2R)-2-fluorocyclopentan-1-amine;hydrochloride. InChIKey: ZJXOEOALNHXCOE-TYSVMGFPSA-N.
| Molecular formula | C5H11ClFN |
|---|---|
| Molecular weight | 139.60 g/mol |
| IUPAC name | trans-(1R,2R)-2-fluorocyclopentan-1-amine;hydrochloride |
| InChIKey | ZJXOEOALNHXCOE-TYSVMGFPSA-N |
| SMILES | C1C[C@H]([C@@H](C1)F)N.Cl |
Computed by PubChem (NCBI)