CAS 2227197-40-0 appears in our catalog under these names: (1R,2R)-2-Fluorocyclopentan-1-amine hydrochloride, 95%, (1R,2R)-2-Fluorocyclopentan-1-amine Hydrochloride. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 100mg, 5g, 1g, 250mg, 25mg, 50mg.
Trans-(1R,2R)-2-fluorocyclopentan-1-amine;hydrochloride (CAS 2227197-40-0) is a chemical compound with the molecular formula C5H11ClFN and a molecular weight of 139.60 g/mol. IUPAC name: trans-(1R,2R)-2-fluorocyclopentan-1-amine;hydrochloride. InChIKey: ZJXOEOALNHXCOE-TYSVMGFPSA-N.
| Molecular formula | C5H11ClFN |
|---|---|
| Molecular weight | 139.60 g/mol |
| IUPAC name | trans-(1R,2R)-2-fluorocyclopentan-1-amine;hydrochloride |
| InChIKey | ZJXOEOALNHXCOE-TYSVMGFPSA-N |
| SMILES | C1C[C@H]([C@@H](C1)F)N.Cl |
Computed by PubChem (NCBI)