CAS 2126-78-5 appears in our catalog under these names: (+)-Isolysergic Acid Diethylamide, >95% (HPLC), Iso-LSD, Iso-LSD (Iso-Lysergic Acid Diethylamide, Iso-Lysergide), Iso-LSD, 0.1mg/ml in Acetonitrile, Iso-LSD, 1mg/ml in Acetonitrile. Offered by: TRC, Lipomed, LoGiCal, GLPBio, Biosynth. Available pack sizes: 10mg, 1mg, 50mg, 100mg, 5mg, 1ml, 100μg.
(6aR,9S)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (CAS 2126-78-5) is a chemical compound with the molecular formula C20H25N3O and a molecular weight of 323.4 g/mol. IUPAC name: (6aR,9S)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide. InChIKey: VAYOSLLFUXYJDT-KBXCAEBGSA-N.
| Molecular formula | C20H25N3O |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | (6aR,9S)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChIKey | VAYOSLLFUXYJDT-KBXCAEBGSA-N |
| SMILES | CCN(CC)C(=O)[C@@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1)C |
Computed by PubChem (NCBI)