CAS 3846-71-7 appears in our catalog under these names: 2-(3,5-Di-tert-butyl-2-hydroxyphenyl)-2H-benzotriazole, UV-320, >95% (HPLC), 2-(2H-Benzo[d][1,2,3]triazol-2-yl)-4,6-di-tert-butylphenol 98%, UV-320. Offered by: Dr. Ehrenstorfer, TRC, Ambeed, HPC Standards. Available pack sizes: 100mg, 25g, 50g, 5g, 1x100mg.
2-(benzotriazol-2-yl)-4,6-ditert-butylphenol (CAS 3846-71-7) is a chemical compound with the molecular formula C20H25N3O and a molecular weight of 323.4 g/mol. IUPAC name: 2-(benzotriazol-2-yl)-4,6-ditert-butylphenol. InChIKey: LHPPDQUVECZQSW-UHFFFAOYSA-N.
| Molecular formula | C20H25N3O |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 2-(benzotriazol-2-yl)-4,6-ditert-butylphenol |
| InChIKey | LHPPDQUVECZQSW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)N2N=C3C=CC=CC3=N2)O)C(C)(C)C |
Computed by PubChem (NCBI)