CAS 2126144-78-1 appears in our catalog under these names: (R,E)-4-((tert-Butyldimethylsilyl)oxy)pent-2-enoic acid, 97%, (R,E)–4–((tert–Butyldimethylsilyl)oxy)pent–2–enoic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 250mg.
(E,4R)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid (CAS 2126144-78-1) is a chemical compound with the molecular formula C11H22O3Si and a molecular weight of 230.38 g/mol. IUPAC name: (E,4R)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid. InChIKey: BQYJTPADGKWSNB-FCZSHJHJSA-N.
| Molecular formula | C11H22O3Si |
|---|---|
| Molecular weight | 230.38 g/mol |
| IUPAC name | (E,4R)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid |
| InChIKey | BQYJTPADGKWSNB-FCZSHJHJSA-N |
| SMILES | C[C@H](/C=C/C(=O)O)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)