CAS 2167748-73-2 is the registry number for 2-(3-((tert-Butyldimethylsilyl)oxy)oxetan-3-yl)acetaldehyde, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-[3-[tert-butyl(dimethyl)silyl]oxyoxetan-3-yl]acetaldehyde (CAS 2167748-73-2) is a chemical compound with the molecular formula C11H22O3Si and a molecular weight of 230.38 g/mol. IUPAC name: 2-[3-[tert-butyl(dimethyl)silyl]oxyoxetan-3-yl]acetaldehyde. InChIKey: CMNSPCLDOXXJDV-UHFFFAOYSA-N.
| Molecular formula | C11H22O3Si |
|---|---|
| Molecular weight | 230.38 g/mol |
| IUPAC name | 2-[3-[tert-butyl(dimethyl)silyl]oxyoxetan-3-yl]acetaldehyde |
| InChIKey | CMNSPCLDOXXJDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1(COC1)CC=O |
Computed by PubChem (NCBI)