CAS 2126159-54-2 is the registry number for 4,4-Difluoro-1-(trifluoromethyl)cyclohexan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4,4-difluoro-1-(trifluoromethyl)cyclohexan-1-amine;hydrochloride (CAS 2126159-54-2) is a chemical compound with the molecular formula C7H11ClF5N and a molecular weight of 239.61 g/mol. IUPAC name: 4,4-difluoro-1-(trifluoromethyl)cyclohexan-1-amine;hydrochloride. InChIKey: YNFFBCPTPURNHK-UHFFFAOYSA-N.
| Molecular formula | C7H11ClF5N |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 4,4-difluoro-1-(trifluoromethyl)cyclohexan-1-amine;hydrochloride |
| InChIKey | YNFFBCPTPURNHK-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1(C(F)(F)F)N)(F)F.Cl |
Computed by PubChem (NCBI)