CAS 2361725-61-1 is the registry number for 3-(Pentafluoroethyl)piperidine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1,1,2,2,2-pentafluoroethyl)piperidine;hydrochloride (CAS 2361725-61-1) is a chemical compound with the molecular formula C7H11ClF5N and a molecular weight of 239.61 g/mol. IUPAC name: 3-(1,1,2,2,2-pentafluoroethyl)piperidine;hydrochloride. InChIKey: OKKFNVGTERLRMA-UHFFFAOYSA-N.
| Molecular formula | C7H11ClF5N |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 3-(1,1,2,2,2-pentafluoroethyl)piperidine;hydrochloride |
| InChIKey | OKKFNVGTERLRMA-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C(C(F)(F)F)(F)F.Cl |
Computed by PubChem (NCBI)