CAS 2126176-76-7 appears in our catalog under these names: tert-Butyl 3-(piperidin-4-yloxy)azetidine-1-carboxylate hydrochloride, 95%, tert-Butyl 3-(piperidin-4-yloxy)azetidine-1-carboxylate hydrochloride, tert-butyl 3-(piperidin-4-yloxy)azetidine-1-carboxylate HCl 97%, tert-Butyl 3-(piperidin-4-yloxy)azetidine-1-carboxylate hydrochloride, 97%, 97%, tert-Butyl 3-(piperidin-4-yloxy)azetidine-1-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg, Get quote.
Tert-butyl 3-piperidin-4-yloxyazetidine-1-carboxylate;hydrochloride (CAS 2126176-76-7) is a chemical compound with the molecular formula C13H25ClN2O3 and a molecular weight of 292.80 g/mol. IUPAC name: tert-butyl 3-piperidin-4-yloxyazetidine-1-carboxylate;hydrochloride. InChIKey: UIKDPQADJWQESJ-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O3 |
|---|---|
| Molecular weight | 292.80 g/mol |
| IUPAC name | tert-butyl 3-piperidin-4-yloxyazetidine-1-carboxylate;hydrochloride |
| InChIKey | UIKDPQADJWQESJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)OC2CCNCC2.Cl |
Computed by PubChem (NCBI)