Products 2759182-59-5
CAS 2759182-59-5 appears in our catalog under these names: Neboglamine hydrochloride, Neboglamine hydrochloride/ 99.11% (existing batch purity), Neboglamine (hydrochloride), Neboglamine (hydrochloride), 97.02%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 10mM/1mL.
(4S)-4-amino-5-[(4,4-dimethylcyclohexyl)amino]-5-oxopentanoic acid;hydrochloride (CAS 2759182-59-5) is a chemical compound with the molecular formula C13H25ClN2O3 and a molecular weight of 292.80 g/mol. IUPAC name: (4S)-4-amino-5-[(4,4-dimethylcyclohexyl)amino]-5-oxopentanoic acid;hydrochloride. InChIKey: HBFGFOLPJKUNCS-PPHPATTJSA-N.
| Molecular formula | C13H25ClN2O3 |
|---|---|
| Molecular weight | 292.80 g/mol |
| IUPAC name | (4S)-4-amino-5-[(4,4-dimethylcyclohexyl)amino]-5-oxopentanoic acid;hydrochloride |
| InChIKey | HBFGFOLPJKUNCS-PPHPATTJSA-N |
| SMILES | CC1(CCC(CC1)NC(=O)[C@H](CCC(=O)O)N)C.Cl |
Computed by PubChem (NCBI)