CAS 2126176-90-5 is the registry number for 4-(5-Chloro-2-methylphenyl)piperidine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(5-chloro-2-methylphenyl)piperidine;hydrochloride (CAS 2126176-90-5) is a chemical compound with the molecular formula C12H17Cl2N and a molecular weight of 246.17 g/mol. IUPAC name: 4-(5-chloro-2-methylphenyl)piperidine;hydrochloride. InChIKey: MUKLKAVZIXAKRO-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N |
|---|---|
| Molecular weight | 246.17 g/mol |
| IUPAC name | 4-(5-chloro-2-methylphenyl)piperidine;hydrochloride |
| InChIKey | MUKLKAVZIXAKRO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)C2CCNCC2.Cl |
Computed by PubChem (NCBI)