CAS 2126178-22-9 is the registry number for 5-((4-Methylpiperazin-1-yl)methyl)thiophene-2-carboxylic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-[(4-methylpiperazin-1-yl)methyl]thiophene-2-carboxylic acid;dihydrochloride (CAS 2126178-22-9) is a chemical compound with the molecular formula C11H18Cl2N2O2S and a molecular weight of 313.2 g/mol. IUPAC name: 5-[(4-methylpiperazin-1-yl)methyl]thiophene-2-carboxylic acid;dihydrochloride. InChIKey: MGKUYMQFRYHKPU-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2O2S |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 5-[(4-methylpiperazin-1-yl)methyl]thiophene-2-carboxylic acid;dihydrochloride |
| InChIKey | MGKUYMQFRYHKPU-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=C(S2)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)