Products 2251053-21-9
CAS 2251053-21-9 appears in our catalog under these names: 4-[3-(Aminomethyl)phenyl]thiomorpholine-1,1-dione dihydrochloride, 95%, 4-(3-(Aminomethyl)phenyl)thiomorpholine 1,1-dioxide dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
[3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methanamine;dihydrochloride (CAS 2251053-21-9) is a chemical compound with the molecular formula C11H18Cl2N2O2S and a molecular weight of 313.2 g/mol. IUPAC name: [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methanamine;dihydrochloride. InChIKey: WNMASXAXIYVQBJ-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2O2S |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methanamine;dihydrochloride |
| InChIKey | WNMASXAXIYVQBJ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=CC=CC(=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)