CAS 2126178-74-1 appears in our catalog under these names: 3-(5-nitro-1h-1,3-benzodiazol-2-yl)propan-1-amine dihydrochloride, 95%, 3-(5-Nitro-1H-benzo(d)imidazol-2-yl)propan-1-amine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-(6-nitro-1H-benzimidazol-2-yl)propan-1-amine;dihydrochloride (CAS 2126178-74-1) is a chemical compound with the molecular formula C10H14Cl2N4O2 and a molecular weight of 293.15 g/mol. IUPAC name: 3-(6-nitro-1H-benzimidazol-2-yl)propan-1-amine;dihydrochloride. InChIKey: PDRPNORSMMBMEG-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N4O2 |
|---|---|
| Molecular weight | 293.15 g/mol |
| IUPAC name | 3-(6-nitro-1H-benzimidazol-2-yl)propan-1-amine;dihydrochloride |
| InChIKey | PDRPNORSMMBMEG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC(=N2)CCCN.Cl.Cl |
Computed by PubChem (NCBI)