CAS 2703752-12-7 is the registry number for 6,7-Dimethoxyquinazoline-2,4-diamine dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6,7-dimethoxyquinazoline-2,4-diamine;dihydrochloride (CAS 2703752-12-7) is a chemical compound with the molecular formula C10H14Cl2N4O2 and a molecular weight of 293.15 g/mol. IUPAC name: 6,7-dimethoxyquinazoline-2,4-diamine;dihydrochloride. InChIKey: CDVARJHAXQQOTQ-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N4O2 |
|---|---|
| Molecular weight | 293.15 g/mol |
| IUPAC name | 6,7-dimethoxyquinazoline-2,4-diamine;dihydrochloride |
| InChIKey | CDVARJHAXQQOTQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)N)N)OC.Cl.Cl |
Computed by PubChem (NCBI)