Products 212625-79-1
CAS 212625-79-1 appears in our catalog under these names: Pyrrolidine-2,2,3,3,4,4,5,5-d8, 98 atom % D, min 98% Chemical Purity, Pyrrolidine-d8, PYRROLIDINE–2，2，3，3，4，4，5，5–D8, PYRROLIDINE-2,2,3,3,4,4,5,5-D8,. Offered by: CDN, TRC, GLPBio, Sigma-Aldrich. Available pack sizes: 0,5g, 0,25g, 250mg, 25mg, 5mg, 1G.
2,2,3,3,4,4,5,5-octadeuteriopyrrolidine (CAS 212625-79-1) is a chemical compound with the molecular formula C4H9N and a molecular weight of 79.17 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octadeuteriopyrrolidine. InChIKey: RWRDLPDLKQPQOW-SVYQBANQSA-N.
| Molecular formula | C4H9N |
|---|---|
| Molecular weight | 79.17 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octadeuteriopyrrolidine |
| InChIKey | RWRDLPDLKQPQOW-SVYQBANQSA-N |
| SMILES | [2H]C1(C(C(NC1([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)